C26H38O6 — CID 172869081
(2S,3S,4S,7S)-3,4-bis[(3,4-dimethoxyphenyl)methyl]octane-2,7-diol (PubChem CID 172869081) has the molecular formula C26H38O6 and a molecular weight of 446.58 g/mol. Its IUPAC name is (2S,3S,4S,7S)-3,4-bis[(3,4-dimethoxyphenyl)methyl]octane-2,7-diol.
| Compound Name | (2S,3S,4S,7S)-3,4-bis[(3,4-dimethoxyphenyl)methyl]octane-2,7-diol |
|---|---|
| PubChem CID | 172869081 |
| Molecular Formula | C26H38O6 |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | (2S,3S,4S,7S)-3,4-bis[(3,4-dimethoxyphenyl)methyl]octane-2,7-diol |
| SMILES | COc1ccc(C[C@H](CC[C@H](C)O)[C@H](Cc2ccc(OC)c(OC)c2)[C@H](C)O)cc1OC |
| InChI | InChI=1S/C26H38O6/c1-17(27)7-10-21(13-19-8-11-23(29-3)25(15-19)31-5)22(18(2)28)14-20-9-12-24(30-4)26(16-20)32-6/h8-9,11-12,15-18,21-22,27-28H,7,10,13-14H2,1-6H3/t17-,18-,21-,22+/m0/s1 |
| InChIKey | BWDZSXYSZYJVSY-YHDSQAASSA-N |
| XLogP | 4.28 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |