About 4-(2-aminopropyl)phenol;dihydrobromide
4-(2-aminopropyl)phenol;dihydrobromide (PubChem CID 23615767) has the molecular formula C9H15Br2NO
and a molecular weight of 313.03 g/mol. Its IUPAC name is 4-(2-aminopropyl)phenol;dihydrobromide.
Molecular Properties
| Compound Name | 4-(2-aminopropyl)phenol;dihydrobromide |
| PubChem CID | 23615767 |
| Molecular Formula | C9H15Br2NO |
| Molecular Weight | 313.03 g/mol |
| Exact Mass | 310.95 |
| IUPAC Name | 4-(2-aminopropyl)phenol;dihydrobromide |
| SMILES | Br.Br.CC(N)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C9H13NO.2BrH/c1-7(10)6-8-2-4-9(11)5-3-8;;/h2-5,7,11H,6,10H2,1H3;2*1H |
| InChIKey | BKXNQOFRIKTLJY-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.03 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(2-aminopropyl)phenol;dihydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-aminopropyl)phenol;dihydrobromide?
The IUPAC name of 4-(2-aminopropyl)phenol;dihydrobromide (CID 23615767) is 4-(2-aminopropyl)phenol;dihydrobromide.
What is the SMILES notation for 4-(2-aminopropyl)phenol;dihydrobromide?
The canonical SMILES for 4-(2-aminopropyl)phenol;dihydrobromide is Br.Br.CC(N)Cc1ccc(O)cc1.
What is the InChIKey of 4-(2-aminopropyl)phenol;dihydrobromide?
The InChIKey is BKXNQOFRIKTLJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO.2BrH/c1-7(10)6-8-2-4-9(11)5-3-8;;/h2-5,7,11H,6,10H2,1H3;2*1H.
What are the key properties of 4-(2-aminopropyl)phenol;dihydrobromide?
4-(2-aminopropyl)phenol;dihydrobromide has a molecular weight of 313.03 g/mol, XLogP of 2.44, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-aminopropyl)phenol;dihydrobromide is sourced from PubChem (CID 23615767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).