C21H30ClNO3 — CID 158091851
4-[(2S)-2-aminopropyl]phenol;(4S)-5-(4-hydroxyphenyl)-4-methylpentan-2-one;hydrochloride (PubChem CID 158091851) has the molecular formula C21H30ClNO3 and a molecular weight of 379.93 g/mol. Its IUPAC name is 4-[(2S)-2-aminopropyl]phenol;(4S)-5-(4-hydroxyphenyl)-4-methylpentan-2-one;hydrochloride.
| Compound Name | 4-[(2S)-2-aminopropyl]phenol;(4S)-5-(4-hydroxyphenyl)-4-methylpentan-2-one;hydrochloride |
|---|---|
| PubChem CID | 158091851 |
| Molecular Formula | C21H30ClNO3 |
| Molecular Weight | 379.93 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 4-[(2S)-2-aminopropyl]phenol;(4S)-5-(4-hydroxyphenyl)-4-methylpentan-2-one;hydrochloride |
| SMILES | CC(=O)C[C@@H](C)Cc1ccc(O)cc1.C[C@H](N)Cc1ccc(O)cc1.Cl |
| InChI | InChI=1S/C12H16O2.C9H13NO.ClH/c1-9(7-10(2)13)8-11-3-5-12(14)6-4-11;1-7(10)6-8-2-4-9(11)5-3-8;/h3-6,9,14H,7-8H2,1-2H3;2-5,7,11H,6,10H2,1H3;1H/t9-;7-;/m10./s1 |
| InChIKey | RNWQSHFFOFQTQJ-FIJWQQMXSA-N |
| XLogP | 4.25 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.93 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |