C17H25NO3 — CID 60880078
methyl 4-[4-[(cyclopropylamino)methyl]-2,6-dimethylphenoxy]butanoate (PubChem CID 60880078) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is methyl 4-[4-[(cyclopropylamino)methyl]-2,6-dimethylphenoxy]butanoate.
| Compound Name | methyl 4-[4-[(cyclopropylamino)methyl]-2,6-dimethylphenoxy]butanoate |
|---|---|
| PubChem CID | 60880078 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | methyl 4-[4-[(cyclopropylamino)methyl]-2,6-dimethylphenoxy]butanoate |
| SMILES | COC(=O)CCCOc1c(C)cc(CNC2CC2)cc1C |
| InChI | InChI=1S/C17H25NO3/c1-12-9-14(11-18-15-6-7-15)10-13(2)17(12)21-8-4-5-16(19)20-3/h9-10,15,18H,4-8,11H2,1-3H3 |
| InChIKey | UFFMCTJMYXPUIT-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|