C15H19Br2NO3 — CID 107743136
methyl 4-[2,6-dibromo-4-[(cyclopropylamino)methyl]phenoxy]butanoate (PubChem CID 107743136) has the molecular formula C15H19Br2NO3 and a molecular weight of 421.13 g/mol. Its IUPAC name is methyl 4-[2,6-dibromo-4-[(cyclopropylamino)methyl]phenoxy]butanoate.
| Compound Name | methyl 4-[2,6-dibromo-4-[(cyclopropylamino)methyl]phenoxy]butanoate |
|---|---|
| PubChem CID | 107743136 |
| Molecular Formula | C15H19Br2NO3 |
| Molecular Weight | 421.13 g/mol |
| Exact Mass | 418.97 |
| IUPAC Name | methyl 4-[2,6-dibromo-4-[(cyclopropylamino)methyl]phenoxy]butanoate |
| SMILES | COC(=O)CCCOc1c(Br)cc(CNC2CC2)cc1Br |
| InChI | InChI=1S/C15H19Br2NO3/c1-20-14(19)3-2-6-21-15-12(16)7-10(8-13(15)17)9-18-11-4-5-11/h7-8,11,18H,2-6,9H2,1H3 |
| InChIKey | WPJXIFISLMGYQN-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.13 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|