C25H29ClN2O4 — CID 139310880
(1E,6E)-1-[4-(2-aminoethoxy)-3-methylphenyl]-7-[4-[2-(chloroamino)ethoxy]-3-methylphenyl]hepta-1,6-diene-3,5-dione (PubChem CID 139310880) has the molecular formula C25H29ClN2O4 and a molecular weight of 456.97 g/mol. Its IUPAC name is (1E,6E)-1-[4-(2-aminoethoxy)-3-methylphenyl]-7-[4-[2-(chloroamino)ethoxy]-3-methylphenyl]hepta-1,6-diene-3,5-dione.
| Compound Name | (1E,6E)-1-[4-(2-aminoethoxy)-3-methylphenyl]-7-[4-[2-(chloroamino)ethoxy]-3-methylphenyl]hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 139310880 |
| Molecular Formula | C25H29ClN2O4 |
| Molecular Weight | 456.97 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | (1E,6E)-1-[4-(2-aminoethoxy)-3-methylphenyl]-7-[4-[2-(chloroamino)ethoxy]-3-methylphenyl]hepta-1,6-diene-3,5-dione |
| SMILES | Cc1cc(/C=C/C(=O)CC(=O)/C=C/c2ccc(OCCNCl)c(C)c2)ccc1OCCN |
| InChI | InChI=1S/C25H29ClN2O4/c1-18-15-20(5-9-24(18)31-13-11-27)3-7-22(29)17-23(30)8-4-21-6-10-25(19(2)16-21)32-14-12-28-26/h3-10,15-16,28H,11-14,17,27H2,1-2H3/b7-3+,8-4+ |
| InChIKey | YIGHRNCOSSSFME-FCXRPNKRSA-N |
| XLogP | 4.02 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.97 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|