C32H32N2O3 — CID 126635887
(1E,6E)-1,7-bis[6-(2-aminoethoxy)naphthalen-2-yl]-5-methylidenehepta-1,6-dien-3-one (PubChem CID 126635887) has the molecular formula C32H32N2O3 and a molecular weight of 492.62 g/mol. Its IUPAC name is (1E,6E)-1,7-bis[6-(2-aminoethoxy)naphthalen-2-yl]-5-methylidenehepta-1,6-dien-3-one.
| Compound Name | (1E,6E)-1,7-bis[6-(2-aminoethoxy)naphthalen-2-yl]-5-methylidenehepta-1,6-dien-3-one |
|---|---|
| PubChem CID | 126635887 |
| Molecular Formula | C32H32N2O3 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | (1E,6E)-1,7-bis[6-(2-aminoethoxy)naphthalen-2-yl]-5-methylidenehepta-1,6-dien-3-one |
| SMILES | C=C(/C=C/c1ccc2cc(OCCN)ccc2c1)CC(=O)/C=C/c1ccc2cc(OCCN)ccc2c1 |
| InChI | InChI=1S/C32H32N2O3/c1-23(2-3-24-4-7-28-21-31(36-16-14-33)12-9-26(28)19-24)18-30(35)11-6-25-5-8-29-22-32(37-17-15-34)13-10-27(29)20-25/h2-13,19-22H,1,14-18,33-34H2/b3-2+,11-6+ |
| InChIKey | RUKBGVFUVHMSSU-PDGXAJGZSA-N |
| XLogP | 5.91 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|