C40H60N2O5 — CID 131968486
(1E,6E)-1-[4-(2-aminoethoxy)-3-nonylphenyl]-7-[4-(2-aminoethoxy)-3-octoxyphenyl]hepta-1,6-diene-3,5-dione (PubChem CID 131968486) has the molecular formula C40H60N2O5 and a molecular weight of 648.93 g/mol. Its IUPAC name is (1E,6E)-1-[4-(2-aminoethoxy)-3-nonylphenyl]-7-[4-(2-aminoethoxy)-3-octoxyphenyl]hepta-1,6-diene-3,5-dione.
| Compound Name | (1E,6E)-1-[4-(2-aminoethoxy)-3-nonylphenyl]-7-[4-(2-aminoethoxy)-3-octoxyphenyl]hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 131968486 |
| Molecular Formula | C40H60N2O5 |
| Molecular Weight | 648.93 g/mol |
| Exact Mass | 648.45 |
| IUPAC Name | (1E,6E)-1-[4-(2-aminoethoxy)-3-nonylphenyl]-7-[4-(2-aminoethoxy)-3-octoxyphenyl]hepta-1,6-diene-3,5-dione |
| SMILES | CCCCCCCCCc1cc(/C=C/C(=O)CC(=O)/C=C/c2ccc(OCCN)c(OCCCCCCCC)c2)ccc1OCCN |
| InChI | InChI=1S/C40H60N2O5/c1-3-5-7-9-11-12-14-16-35-30-33(19-23-38(35)46-28-25-41)17-21-36(43)32-37(44)22-18-34-20-24-39(47-29-26-42)40(31-34)45-27-15-13-10-8-6-4-2/h17-24,30-31H,3-16,25-29,32,41-42H2,1-2H3/b21-17+,22-18+ |
| InChIKey | YEIZWQSFNROHMZ-KSTNYAOJSA-N |
| XLogP | 8.65 |
| TPSA | 113.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.93 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|