C24H29NO6 — CID 139310675
(1E,6E)-1-[4-(2-aminoethoxy)-3-methoxycyclohexa-1,3-dien-1-yl]-7-(3,4-dimethoxyphenyl)hepta-1,6-diene-3,5-dione (PubChem CID 139310675) has the molecular formula C24H29NO6 and a molecular weight of 427.50 g/mol. Its IUPAC name is (1E,6E)-1-[4-(2-aminoethoxy)-3-methoxycyclohexa-1,3-dien-1-yl]-7-(3,4-dimethoxyphenyl)hepta-1,6-diene-3,5-dione.
| Compound Name | (1E,6E)-1-[4-(2-aminoethoxy)-3-methoxycyclohexa-1,3-dien-1-yl]-7-(3,4-dimethoxyphenyl)hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 139310675 |
| Molecular Formula | C24H29NO6 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | (1E,6E)-1-[4-(2-aminoethoxy)-3-methoxycyclohexa-1,3-dien-1-yl]-7-(3,4-dimethoxyphenyl)hepta-1,6-diene-3,5-dione |
| SMILES | COC1=C(OCCN)CCC(/C=C/C(=O)CC(=O)/C=C/c2ccc(OC)c(OC)c2)=C1 |
| InChI | InChI=1S/C24H29NO6/c1-28-21-10-6-17(14-23(21)29-2)4-8-19(26)16-20(27)9-5-18-7-11-22(31-13-12-25)24(15-18)30-3/h4-6,8-10,14-15H,7,11-13,16,25H2,1-3H3/b8-4+,9-5+ |
| InChIKey | DAEQXBPQCRKARR-KBXRYBNXSA-N |
| XLogP | 3.36 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|