C28H46N4O — CID 150272080
5-[3-[1-(3,5-diaminophenyl)octan-3-yloxy]octyl]benzene-1,3-diamine (PubChem CID 150272080) has the molecular formula C28H46N4O and a molecular weight of 454.70 g/mol. Its IUPAC name is 5-[3-[1-(3,5-diaminophenyl)octan-3-yloxy]octyl]benzene-1,3-diamine.
| Compound Name | 5-[3-[1-(3,5-diaminophenyl)octan-3-yloxy]octyl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 150272080 |
| Molecular Formula | C28H46N4O |
| Molecular Weight | 454.70 g/mol |
| Exact Mass | 454.37 |
| IUPAC Name | 5-[3-[1-(3,5-diaminophenyl)octan-3-yloxy]octyl]benzene-1,3-diamine |
| SMILES | CCCCCC(CCc1cc(N)cc(N)c1)OC(CCCCC)CCc1cc(N)cc(N)c1 |
| InChI | InChI=1S/C28H46N4O/c1-3-5-7-9-27(13-11-21-15-23(29)19-24(30)16-21)33-28(10-8-6-4-2)14-12-22-17-25(31)20-26(32)18-22/h15-20,27-28H,3-14,29-32H2,1-2H3 |
| InChIKey | GDTWNLJAHZEBKJ-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 113.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.70 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|