C24H38N4O — CID 151614678
5-[4-[6-(3,5-diaminophenyl)hexan-3-yloxy]hexyl]benzene-1,3-diamine (PubChem CID 151614678) has the molecular formula C24H38N4O and a molecular weight of 398.60 g/mol. Its IUPAC name is 5-[4-[6-(3,5-diaminophenyl)hexan-3-yloxy]hexyl]benzene-1,3-diamine.
| Compound Name | 5-[4-[6-(3,5-diaminophenyl)hexan-3-yloxy]hexyl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 151614678 |
| Molecular Formula | C24H38N4O |
| Molecular Weight | 398.60 g/mol |
| Exact Mass | 398.30 |
| IUPAC Name | 5-[4-[6-(3,5-diaminophenyl)hexan-3-yloxy]hexyl]benzene-1,3-diamine |
| SMILES | CCC(CCCc1cc(N)cc(N)c1)OC(CC)CCCc1cc(N)cc(N)c1 |
| InChI | InChI=1S/C24H38N4O/c1-3-23(9-5-7-17-11-19(25)15-20(26)12-17)29-24(4-2)10-6-8-18-13-21(27)16-22(28)14-18/h11-16,23-24H,3-10,25-28H2,1-2H3 |
| InChIKey | QNFXLTOBWYVUIH-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 113.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.60 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|