About ethane;3-propylaniline;vanadium
ethane;3-propylaniline;vanadium (PubChem CID 143596420) has the molecular formula C11H19NV
and a molecular weight of 216.22 g/mol. Its IUPAC name is ethane;3-propylaniline;vanadium.
Molecular Properties
| Compound Name | ethane;3-propylaniline;vanadium |
| PubChem CID | 143596420 |
| Molecular Formula | C11H19NV |
| Molecular Weight | 216.22 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | ethane;3-propylaniline;vanadium |
| SMILES | CC.CCCc1cccc(N)c1.[V] |
| InChI | InChI=1S/C9H13N.C2H6.V/c1-2-4-8-5-3-6-9(10)7-8;1-2;/h3,5-7H,2,4,10H2,1H3;1-2H3; |
| InChIKey | MGNVTNABHWEVRM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.22 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-propylaniline;vanadium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-propylaniline;vanadium?
The IUPAC name of ethane;3-propylaniline;vanadium (CID 143596420) is ethane;3-propylaniline;vanadium.
What is the SMILES notation for ethane;3-propylaniline;vanadium?
The canonical SMILES for ethane;3-propylaniline;vanadium is CC.CCCc1cccc(N)c1.[V].
What is the InChIKey of ethane;3-propylaniline;vanadium?
The InChIKey is MGNVTNABHWEVRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N.C2H6.V/c1-2-4-8-5-3-6-9(10)7-8;1-2;/h3,5-7H,2,4,10H2,1H3;1-2H3;.
What are the key properties of ethane;3-propylaniline;vanadium?
ethane;3-propylaniline;vanadium has a molecular weight of 216.22 g/mol, XLogP of 3.24, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-propylaniline;vanadium is sourced from PubChem (CID 143596420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).