About 3-(4-fluorophenyl)propylazanide;3-propylaniline;tungsten
3-(4-fluorophenyl)propylazanide;3-propylaniline;tungsten (PubChem CID 170631465) has the molecular formula C18H24FN2W-
and a molecular weight of 471.24 g/mol. Its IUPAC name is 3-(4-fluorophenyl)propylazanide;3-propylaniline;tungsten.
Molecular Properties
| Compound Name | 3-(4-fluorophenyl)propylazanide;3-propylaniline;tungsten |
| PubChem CID | 170631465 |
| Molecular Formula | C18H24FN2W- |
| Molecular Weight | 471.24 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | 3-(4-fluorophenyl)propylazanide;3-propylaniline;tungsten |
| SMILES | CCCc1cccc(N)c1.[NH-]CCCc1ccc(F)cc1.[W] |
| InChI | InChI=1S/C9H11FN.C9H13N.W/c10-9-5-3-8(4-6-9)2-1-7-11;1-2-4-8-5-3-6-9(10)7-8;/h3-6,11H,1-2,7H2;3,5-7H,2,4,10H2,1H3;/q-1;; |
| InChIKey | RUDAUPXNUAEOEG-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 49.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 471.24 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-fluorophenyl)propylazanide;3-propylaniline;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-fluorophenyl)propylazanide;3-propylaniline;tungsten?
The IUPAC name of 3-(4-fluorophenyl)propylazanide;3-propylaniline;tungsten (CID 170631465) is 3-(4-fluorophenyl)propylazanide;3-propylaniline;tungsten.
What is the SMILES notation for 3-(4-fluorophenyl)propylazanide;3-propylaniline;tungsten?
The canonical SMILES for 3-(4-fluorophenyl)propylazanide;3-propylaniline;tungsten is CCCc1cccc(N)c1.[NH-]CCCc1ccc(F)cc1.[W].
What is the InChIKey of 3-(4-fluorophenyl)propylazanide;3-propylaniline;tungsten?
The InChIKey is RUDAUPXNUAEOEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11FN.C9H13N.W/c10-9-5-3-8(4-6-9)2-1-7-11;1-2-4-8-5-3-6-9(10)7-8;/h3-6,11H,1-2,7H2;3,5-7H,2,4,10H2,1H3;/q-1;;.
What are the key properties of 3-(4-fluorophenyl)propylazanide;3-propylaniline;tungsten?
3-(4-fluorophenyl)propylazanide;3-propylaniline;tungsten has a molecular weight of 471.24 g/mol, XLogP of 5.03, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-fluorophenyl)propylazanide;3-propylaniline;tungsten is sourced from PubChem (CID 170631465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).