C14H16F2O — CID 142878399
5-butyl-8,10-difluorocyclodeca-1,3,5,7,9-pentaen-1-ol (PubChem CID 142878399) has the molecular formula C14H16F2O and a molecular weight of 238.28 g/mol. Its IUPAC name is 5-butyl-8,10-difluorocyclodeca-1,3,5,7,9-pentaen-1-ol.
| Compound Name | 5-butyl-8,10-difluorocyclodeca-1,3,5,7,9-pentaen-1-ol |
|---|---|
| PubChem CID | 142878399 |
| Molecular Formula | C14H16F2O |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 5-butyl-8,10-difluorocyclodeca-1,3,5,7,9-pentaen-1-ol |
| SMILES | CCCCc1cccc(O)c(F)cc(F)cc1 |
| InChI | InChI=1S/C14H16F2O/c1-2-3-5-11-6-4-7-14(17)13(16)10-12(15)9-8-11/h4,6-10,17H,2-3,5H2,1H3/b6-4-,7-4-,9-8-,11-6+,11-8+,12-9+,12-10+,13-10-,14-7+,14-13+ |
| InChIKey | ZNMWVUZPWKHHQD-RNEYFJFUSA-N |
| XLogP | 4.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |