C10H12Br2N2O2 — CID 51944658
1-(2,4-dibromophenyl)-3-[(2S)-2-hydroxypropyl]urea (PubChem CID 51944658) has the molecular formula C10H12Br2N2O2 and a molecular weight of 352.03 g/mol. Its IUPAC name is 1-(2,4-dibromophenyl)-3-[(2S)-2-hydroxypropyl]urea.
| Compound Name | 1-(2,4-dibromophenyl)-3-[(2S)-2-hydroxypropyl]urea |
|---|---|
| PubChem CID | 51944658 |
| Molecular Formula | C10H12Br2N2O2 |
| Molecular Weight | 352.03 g/mol |
| Exact Mass | 349.93 |
| IUPAC Name | 1-(2,4-dibromophenyl)-3-[(2S)-2-hydroxypropyl]urea |
| SMILES | C[C@H](O)CNC(=O)Nc1ccc(Br)cc1Br |
| InChI | InChI=1S/C10H12Br2N2O2/c1-6(15)5-13-10(16)14-9-3-2-7(11)4-8(9)12/h2-4,6,15H,5H2,1H3,(H2,13,14,16)/t6-/m0/s1 |
| InChIKey | UQZPPUJPDPUUKY-LURJTMIESA-N |
| XLogP | 2.71 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.03 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |