C12H16Br2N2O — CID 113440855
5-amino-N-(2,4-dibromophenyl)-2-methylpentanamide (PubChem CID 113440855) has the molecular formula C12H16Br2N2O and a molecular weight of 364.08 g/mol. Its IUPAC name is 5-amino-N-(2,4-dibromophenyl)-2-methylpentanamide.
| Compound Name | 5-amino-N-(2,4-dibromophenyl)-2-methylpentanamide |
|---|---|
| PubChem CID | 113440855 |
| Molecular Formula | C12H16Br2N2O |
| Molecular Weight | 364.08 g/mol |
| Exact Mass | 361.96 |
| IUPAC Name | 5-amino-N-(2,4-dibromophenyl)-2-methylpentanamide |
| SMILES | CC(CCCN)C(=O)Nc1ccc(Br)cc1Br |
| InChI | InChI=1S/C12H16Br2N2O/c1-8(3-2-6-15)12(17)16-11-5-4-9(13)7-10(11)14/h4-5,7-8H,2-3,6,15H2,1H3,(H,16,17) |
| InChIKey | FEEAAWKNJAUJTD-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.08 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |