C12H15F3N2O — CID 104685005
5-amino-2-methyl-N-(2,4,5-trifluorophenyl)pentanamide (PubChem CID 104685005) has the molecular formula C12H15F3N2O and a molecular weight of 260.26 g/mol. Its IUPAC name is 5-amino-2-methyl-N-(2,4,5-trifluorophenyl)pentanamide.
| Compound Name | 5-amino-2-methyl-N-(2,4,5-trifluorophenyl)pentanamide |
|---|---|
| PubChem CID | 104685005 |
| Molecular Formula | C12H15F3N2O |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 5-amino-2-methyl-N-(2,4,5-trifluorophenyl)pentanamide |
| SMILES | CC(CCCN)C(=O)Nc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C12H15F3N2O/c1-7(3-2-4-16)12(18)17-11-6-9(14)8(13)5-10(11)15/h5-7H,2-4,16H2,1H3,(H,17,18) |
| InChIKey | CIUNLBKWXMVLIY-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|