C12H15F3N2O — CID 62814873
2-(aminomethyl)-3-methyl-N-(2,4,5-trifluorophenyl)butanamide (PubChem CID 62814873) has the molecular formula C12H15F3N2O and a molecular weight of 260.26 g/mol. Its IUPAC name is 2-(aminomethyl)-3-methyl-N-(2,4,5-trifluorophenyl)butanamide.
| Compound Name | 2-(aminomethyl)-3-methyl-N-(2,4,5-trifluorophenyl)butanamide |
|---|---|
| PubChem CID | 62814873 |
| Molecular Formula | C12H15F3N2O |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 2-(aminomethyl)-3-methyl-N-(2,4,5-trifluorophenyl)butanamide |
| SMILES | CC(C)C(CN)C(=O)Nc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C12H15F3N2O/c1-6(2)7(5-16)12(18)17-11-4-9(14)8(13)3-10(11)15/h3-4,6-7H,5,16H2,1-2H3,(H,17,18) |
| InChIKey | DLIJHGPOAWZALR-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|