C13H18Br2N2O2 — CID 115666901
N-(2,4-dibromophenyl)-2-[3-hydroxybutyl(methyl)amino]acetamide (PubChem CID 115666901) has the molecular formula C13H18Br2N2O2 and a molecular weight of 394.11 g/mol. Its IUPAC name is N-(2,4-dibromophenyl)-2-[3-hydroxybutyl(methyl)amino]acetamide.
| Compound Name | N-(2,4-dibromophenyl)-2-[3-hydroxybutyl(methyl)amino]acetamide |
|---|---|
| PubChem CID | 115666901 |
| Molecular Formula | C13H18Br2N2O2 |
| Molecular Weight | 394.11 g/mol |
| Exact Mass | 391.97 |
| IUPAC Name | N-(2,4-dibromophenyl)-2-[3-hydroxybutyl(methyl)amino]acetamide |
| SMILES | CC(O)CCN(C)CC(=O)Nc1ccc(Br)cc1Br |
| InChI | InChI=1S/C13H18Br2N2O2/c1-9(18)5-6-17(2)8-13(19)16-12-4-3-10(14)7-11(12)15/h3-4,7,9,18H,5-6,8H2,1-2H3,(H,16,19) |
| InChIKey | FQOANKRPUFRPOO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.11 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |