C13H18F2N2O2 — CID 115665697
N-(3,5-difluorophenyl)-2-[3-hydroxybutyl(methyl)amino]acetamide (PubChem CID 115665697) has the molecular formula C13H18F2N2O2 and a molecular weight of 272.30 g/mol. Its IUPAC name is N-(3,5-difluorophenyl)-2-[3-hydroxybutyl(methyl)amino]acetamide.
| Compound Name | N-(3,5-difluorophenyl)-2-[3-hydroxybutyl(methyl)amino]acetamide |
|---|---|
| PubChem CID | 115665697 |
| Molecular Formula | C13H18F2N2O2 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | N-(3,5-difluorophenyl)-2-[3-hydroxybutyl(methyl)amino]acetamide |
| SMILES | CC(O)CCN(C)CC(=O)Nc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C13H18F2N2O2/c1-9(18)3-4-17(2)8-13(19)16-12-6-10(14)5-11(15)7-12/h5-7,9,18H,3-4,8H2,1-2H3,(H,16,19) |
| InChIKey | TUXXVQJPEFNYGZ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |