C16H26N2O2 — CID 115665846
2-[3-hydroxybutyl(methyl)amino]-N-(2-propan-2-ylphenyl)acetamide (PubChem CID 115665846) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 2-[3-hydroxybutyl(methyl)amino]-N-(2-propan-2-ylphenyl)acetamide.
| Compound Name | 2-[3-hydroxybutyl(methyl)amino]-N-(2-propan-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 115665846 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | 2-[3-hydroxybutyl(methyl)amino]-N-(2-propan-2-ylphenyl)acetamide |
| SMILES | CC(O)CCN(C)CC(=O)Nc1ccccc1C(C)C |
| InChI | InChI=1S/C16H26N2O2/c1-12(2)14-7-5-6-8-15(14)17-16(20)11-18(4)10-9-13(3)19/h5-8,12-13,19H,9-11H2,1-4H3,(H,17,20) |
| InChIKey | ZQXURMLCLQMNLE-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |