C19H18ClN3O6 — CID 58994847
(2S)-2-[[2-[(2-chloro-6-methylphenyl)carbamoylamino]benzoyl]amino]butanedioic acid (PubChem CID 58994847) has the molecular formula C19H18ClN3O6 and a molecular weight of 419.82 g/mol. Its IUPAC name is (2S)-2-[[2-[(2-chloro-6-methylphenyl)carbamoylamino]benzoyl]amino]butanedioic acid.
| Compound Name | (2S)-2-[[2-[(2-chloro-6-methylphenyl)carbamoylamino]benzoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 58994847 |
| Molecular Formula | C19H18ClN3O6 |
| Molecular Weight | 419.82 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | (2S)-2-[[2-[(2-chloro-6-methylphenyl)carbamoylamino]benzoyl]amino]butanedioic acid |
| SMILES | Cc1cccc(Cl)c1NC(=O)Nc1ccccc1C(=O)N[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C19H18ClN3O6/c1-10-5-4-7-12(20)16(10)23-19(29)22-13-8-3-2-6-11(13)17(26)21-14(18(27)28)9-15(24)25/h2-8,14H,9H2,1H3,(H,21,26)(H,24,25)(H,27,28)(H2,22,23,29)/t14-/m0/s1 |
| InChIKey | HZEZJSOIUVLYFF-AWEZNQCLSA-N |
| XLogP | 2.95 |
| TPSA | 144.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.82 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |