C11H12ClN5OS — CID 62241867
2-chloro-N-(4,5-dimethyl-1,3-thiazol-2-yl)-6-hydrazinylpyridine-4-carboxamide (PubChem CID 62241867) has the molecular formula C11H12ClN5OS and a molecular weight of 297.77 g/mol. Its IUPAC name is 2-chloro-N-(4,5-dimethyl-1,3-thiazol-2-yl)-6-hydrazinylpyridine-4-carboxamide.
| Compound Name | 2-chloro-N-(4,5-dimethyl-1,3-thiazol-2-yl)-6-hydrazinylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 62241867 |
| Molecular Formula | C11H12ClN5OS |
| Molecular Weight | 297.77 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | 2-chloro-N-(4,5-dimethyl-1,3-thiazol-2-yl)-6-hydrazinylpyridine-4-carboxamide |
| SMILES | Cc1nc(NC(=O)c2cc(Cl)nc(NN)c2)sc1C |
| InChI | InChI=1S/C11H12ClN5OS/c1-5-6(2)19-11(14-5)16-10(18)7-3-8(12)15-9(4-7)17-13/h3-4H,13H2,1-2H3,(H,15,17)(H,14,16,18) |
| InChIKey | TZPWVDJEKBOKQH-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.77 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|