C8H7ClN6OS — CID 114914433
2-chloro-6-hydrazinyl-N-(thiadiazol-5-yl)pyridine-4-carboxamide (PubChem CID 114914433) has the molecular formula C8H7ClN6OS and a molecular weight of 270.71 g/mol. Its IUPAC name is 2-chloro-6-hydrazinyl-N-(thiadiazol-5-yl)pyridine-4-carboxamide.
| Compound Name | 2-chloro-6-hydrazinyl-N-(thiadiazol-5-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 114914433 |
| Molecular Formula | C8H7ClN6OS |
| Molecular Weight | 270.71 g/mol |
| Exact Mass | 270.01 |
| IUPAC Name | 2-chloro-6-hydrazinyl-N-(thiadiazol-5-yl)pyridine-4-carboxamide |
| SMILES | NNc1cc(C(=O)Nc2cnns2)cc(Cl)n1 |
| InChI | InChI=1S/C8H7ClN6OS/c9-5-1-4(2-6(12-5)14-10)8(16)13-7-3-11-15-17-7/h1-3H,10H2,(H,12,14)(H,13,16) |
| InChIKey | NDRXICRORNNHQZ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.71 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|