C12H11BrClN5O — CID 83170176
N-(5-bromo-3-methyl-2-pyridinyl)-2-chloro-6-hydrazinylpyridine-4-carboxamide (PubChem CID 83170176) has the molecular formula C12H11BrClN5O and a molecular weight of 356.61 g/mol. Its IUPAC name is N-(5-bromo-3-methyl-2-pyridinyl)-2-chloro-6-hydrazinylpyridine-4-carboxamide.
| Compound Name | N-(5-bromo-3-methyl-2-pyridinyl)-2-chloro-6-hydrazinylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 83170176 |
| Molecular Formula | C12H11BrClN5O |
| Molecular Weight | 356.61 g/mol |
| Exact Mass | 354.98 |
| IUPAC Name | N-(5-bromo-3-methyl-2-pyridinyl)-2-chloro-6-hydrazinylpyridine-4-carboxamide |
| SMILES | Cc1cc(Br)cnc1NC(=O)c1cc(Cl)nc(NN)c1 |
| InChI | InChI=1S/C12H11BrClN5O/c1-6-2-8(13)5-16-11(6)18-12(20)7-3-9(14)17-10(4-7)19-15/h2-5H,15H2,1H3,(H,17,19)(H,16,18,20) |
| InChIKey | HDIHJHQQAZMSKY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.61 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|