C13H9BrClN5O — CID 107801433
N-(5-bromo-2-cyanophenyl)-2-chloro-6-hydrazinylpyridine-4-carboxamide (PubChem CID 107801433) has the molecular formula C13H9BrClN5O and a molecular weight of 366.61 g/mol. Its IUPAC name is N-(5-bromo-2-cyanophenyl)-2-chloro-6-hydrazinylpyridine-4-carboxamide.
| Compound Name | N-(5-bromo-2-cyanophenyl)-2-chloro-6-hydrazinylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 107801433 |
| Molecular Formula | C13H9BrClN5O |
| Molecular Weight | 366.61 g/mol |
| Exact Mass | 364.97 |
| IUPAC Name | N-(5-bromo-2-cyanophenyl)-2-chloro-6-hydrazinylpyridine-4-carboxamide |
| SMILES | N#Cc1ccc(Br)cc1NC(=O)c1cc(Cl)nc(NN)c1 |
| InChI | InChI=1S/C13H9BrClN5O/c14-9-2-1-7(6-16)10(5-9)18-13(21)8-3-11(15)19-12(4-8)20-17/h1-5H,17H2,(H,18,21)(H,19,20) |
| InChIKey | NKFYOALYNWYSLJ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 103.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.61 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|