C16H14Cl2N2O6 — CID 7862447
[2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl] (2R)-2-(2,4-dichlorophenoxy)propanoate (PubChem CID 7862447) has the molecular formula C16H14Cl2N2O6 and a molecular weight of 401.20 g/mol. Its IUPAC name is [2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl] (2R)-2-(2,4-dichlorophenoxy)propanoate.
| Compound Name | [2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl] (2R)-2-(2,4-dichlorophenoxy)propanoate |
|---|---|
| PubChem CID | 7862447 |
| Molecular Formula | C16H14Cl2N2O6 |
| Molecular Weight | 401.20 g/mol |
| Exact Mass | 400.02 |
| IUPAC Name | [2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl] (2R)-2-(2,4-dichlorophenoxy)propanoate |
| SMILES | C[C@@H](Oc1ccc(Cl)cc1Cl)C(=O)OCC(=O)NNC(=O)c1ccco1 |
| InChI | InChI=1S/C16H14Cl2N2O6/c1-9(26-12-5-4-10(17)7-11(12)18)16(23)25-8-14(21)19-20-15(22)13-3-2-6-24-13/h2-7,9H,8H2,1H3,(H,19,21)(H,20,22)/t9-/m1/s1 |
| InChIKey | WHIXPBQSFDVUSI-SECBINFHSA-N |
| XLogP | 2.36 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.20 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|