C15H10BrCl2N3O5 — CID 4633302
N'-[2-(4-bromo-2-chlorophenoxy)acetyl]-4-chloro-3-nitrobenzohydrazide (PubChem CID 4633302) has the molecular formula C15H10BrCl2N3O5 and a molecular weight of 463.07 g/mol. Its IUPAC name is N'-[2-(4-bromo-2-chlorophenoxy)acetyl]-4-chloro-3-nitrobenzohydrazide.
| Compound Name | N'-[2-(4-bromo-2-chlorophenoxy)acetyl]-4-chloro-3-nitrobenzohydrazide |
|---|---|
| PubChem CID | 4633302 |
| Molecular Formula | C15H10BrCl2N3O5 |
| Molecular Weight | 463.07 g/mol |
| Exact Mass | 460.92 |
| IUPAC Name | N'-[2-(4-bromo-2-chlorophenoxy)acetyl]-4-chloro-3-nitrobenzohydrazide |
| SMILES | O=C(COc1ccc(Br)cc1Cl)NNC(=O)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H10BrCl2N3O5/c16-9-2-4-13(11(18)6-9)26-7-14(22)19-20-15(23)8-1-3-10(17)12(5-8)21(24)25/h1-6H,7H2,(H,19,22)(H,20,23) |
| InChIKey | VWMIPBOFWXQMJI-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.07 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|