C22H17Cl2N3O6 — CID 4535018
2-(4-chlorophenoxy)-N-[3-[[2-(4-chlorophenoxy)acetyl]amino]-4-nitrophenyl]acetamide (PubChem CID 4535018) has the molecular formula C22H17Cl2N3O6 and a molecular weight of 490.30 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[3-[[2-(4-chlorophenoxy)acetyl]amino]-4-nitrophenyl]acetamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[3-[[2-(4-chlorophenoxy)acetyl]amino]-4-nitrophenyl]acetamide |
|---|---|
| PubChem CID | 4535018 |
| Molecular Formula | C22H17Cl2N3O6 |
| Molecular Weight | 490.30 g/mol |
| Exact Mass | 489.05 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[3-[[2-(4-chlorophenoxy)acetyl]amino]-4-nitrophenyl]acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1)Nc1ccc([N+](=O)[O-])c(NC(=O)COc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C22H17Cl2N3O6/c23-14-1-6-17(7-2-14)32-12-21(28)25-16-5-10-20(27(30)31)19(11-16)26-22(29)13-33-18-8-3-15(24)4-9-18/h1-11H,12-13H2,(H,25,28)(H,26,29) |
| InChIKey | BCGLNGDCBPAEQU-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.30 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|