C8H16N2O2S — CID 28780497
N-(3-amino-3-sulfanylidenepropyl)-2-ethoxy-N-methylacetamide (PubChem CID 28780497) has the molecular formula C8H16N2O2S and a molecular weight of 204.29 g/mol. Its IUPAC name is N-(3-amino-3-sulfanylidenepropyl)-2-ethoxy-N-methylacetamide.
| Compound Name | N-(3-amino-3-sulfanylidenepropyl)-2-ethoxy-N-methylacetamide |
|---|---|
| PubChem CID | 28780497 |
| Molecular Formula | C8H16N2O2S |
| Molecular Weight | 204.29 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | N-(3-amino-3-sulfanylidenepropyl)-2-ethoxy-N-methylacetamide |
| SMILES | CCOCC(=O)N(C)CCC(N)=S |
| InChI | InChI=1S/C8H16N2O2S/c1-3-12-6-8(11)10(2)5-4-7(9)13/h3-6H2,1-2H3,(H2,9,13) |
| InChIKey | ZOCGFIWIFSOIDQ-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.29 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|