C13H18BrNO2 — CID 113353141
(3-bromophenyl)methyl (2R)-2-amino-3,3-dimethylbutanoate (PubChem CID 113353141) has the molecular formula C13H18BrNO2 and a molecular weight of 300.20 g/mol. Its IUPAC name is (3-bromophenyl)methyl (2R)-2-amino-3,3-dimethylbutanoate.
| Compound Name | (3-bromophenyl)methyl (2R)-2-amino-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 113353141 |
| Molecular Formula | C13H18BrNO2 |
| Molecular Weight | 300.20 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | (3-bromophenyl)methyl (2R)-2-amino-3,3-dimethylbutanoate |
| SMILES | CC(C)(C)[C@@H](N)C(=O)OCc1cccc(Br)c1 |
| InChI | InChI=1S/C13H18BrNO2/c1-13(2,3)11(15)12(16)17-8-9-5-4-6-10(14)7-9/h4-7,11H,8,15H2,1-3H3/t11-/m0/s1 |
| InChIKey | DWIGFDINJSQFJH-NSHDSACASA-N |
| XLogP | 2.87 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.20 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |