About (3-bromophenyl)methyl (2R)-2-aminobutanoate
(3-bromophenyl)methyl (2R)-2-aminobutanoate (PubChem CID 82823732) has the molecular formula C11H14BrNO2
and a molecular weight of 272.14 g/mol. Its IUPAC name is (3-bromophenyl)methyl (2R)-2-aminobutanoate.
Molecular Properties
| Compound Name | (3-bromophenyl)methyl (2R)-2-aminobutanoate |
| PubChem CID | 82823732 |
| Molecular Formula | C11H14BrNO2 |
| Molecular Weight | 272.14 g/mol |
| Exact Mass | 271.02 |
| IUPAC Name | (3-bromophenyl)methyl (2R)-2-aminobutanoate |
| SMILES | CC[C@@H](N)C(=O)OCc1cccc(Br)c1 |
| InChI | InChI=1S/C11H14BrNO2/c1-2-10(13)11(14)15-7-8-4-3-5-9(12)6-8/h3-6,10H,2,7,13H2,1H3/t10-/m1/s1 |
| InChIKey | LIFFGRCXEXSEIS-SNVBAGLBSA-N |
| XLogP | 2.23 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.14 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-bromophenyl)methyl (2R)-2-aminobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-bromophenyl)methyl (2R)-2-aminobutanoate?
The IUPAC name of (3-bromophenyl)methyl (2R)-2-aminobutanoate (CID 82823732) is (3-bromophenyl)methyl (2R)-2-aminobutanoate.
What is the SMILES notation for (3-bromophenyl)methyl (2R)-2-aminobutanoate?
The canonical SMILES for (3-bromophenyl)methyl (2R)-2-aminobutanoate is CC[C@@H](N)C(=O)OCc1cccc(Br)c1.
What is the InChIKey of (3-bromophenyl)methyl (2R)-2-aminobutanoate?
The InChIKey is LIFFGRCXEXSEIS-SNVBAGLBSA-N. The full InChI is InChI=1S/C11H14BrNO2/c1-2-10(13)11(14)15-7-8-4-3-5-9(12)6-8/h3-6,10H,2,7,13H2,1H3/t10-/m1/s1.
What are the key properties of (3-bromophenyl)methyl (2R)-2-aminobutanoate?
(3-bromophenyl)methyl (2R)-2-aminobutanoate has a molecular weight of 272.14 g/mol, XLogP of 2.23, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-bromophenyl)methyl (2R)-2-aminobutanoate is sourced from PubChem (CID 82823732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).