C14H15FN2O4 — CID 24686300
(3-fluorophenyl)methyl 4-(2,5-dioxoimidazolidin-1-yl)butanoate (PubChem CID 24686300) has the molecular formula C14H15FN2O4 and a molecular weight of 294.28 g/mol. Its IUPAC name is (3-fluorophenyl)methyl 4-(2,5-dioxoimidazolidin-1-yl)butanoate.
| Compound Name | (3-fluorophenyl)methyl 4-(2,5-dioxoimidazolidin-1-yl)butanoate |
|---|---|
| PubChem CID | 24686300 |
| Molecular Formula | C14H15FN2O4 |
| Molecular Weight | 294.28 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | (3-fluorophenyl)methyl 4-(2,5-dioxoimidazolidin-1-yl)butanoate |
| SMILES | O=C(CCCN1C(=O)CNC1=O)OCc1cccc(F)c1 |
| InChI | InChI=1S/C14H15FN2O4/c15-11-4-1-3-10(7-11)9-21-13(19)5-2-6-17-12(18)8-16-14(17)20/h1,3-4,7H,2,5-6,8-9H2,(H,16,20) |
| InChIKey | HJLMHZLGKGECFW-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.28 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|