C17H18N4O5 — CID 8588347
(7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 4-(2,5-dioxoimidazolidin-1-yl)butanoate (PubChem CID 8588347) has the molecular formula C17H18N4O5 and a molecular weight of 358.35 g/mol. Its IUPAC name is (7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 4-(2,5-dioxoimidazolidin-1-yl)butanoate.
| Compound Name | (7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 4-(2,5-dioxoimidazolidin-1-yl)butanoate |
|---|---|
| PubChem CID | 8588347 |
| Molecular Formula | C17H18N4O5 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | (7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 4-(2,5-dioxoimidazolidin-1-yl)butanoate |
| SMILES | Cc1ccc2nc(COC(=O)CCCN3C(=O)CNC3=O)cc(=O)n2c1 |
| InChI | InChI=1S/C17H18N4O5/c1-11-4-5-13-19-12(7-14(22)21(13)9-11)10-26-16(24)3-2-6-20-15(23)8-18-17(20)25/h4-5,7,9H,2-3,6,8,10H2,1H3,(H,18,25) |
| InChIKey | OQSHVAWKOFTYCU-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|