C20H21N3O5 — CID 8521234
(7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]acetate (PubChem CID 8521234) has the molecular formula C20H21N3O5 and a molecular weight of 383.40 g/mol. Its IUPAC name is (7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]acetate.
| Compound Name | (7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]acetate |
|---|---|
| PubChem CID | 8521234 |
| Molecular Formula | C20H21N3O5 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | (7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]acetate |
| SMILES | Cc1ccc2nc(COC(=O)CN3C(=O)[C@H]4CCCC[C@@H]4C3=O)cc(=O)n2c1 |
| InChI | InChI=1S/C20H21N3O5/c1-12-6-7-16-21-13(8-17(24)22(16)9-12)11-28-18(25)10-23-19(26)14-4-2-3-5-15(14)20(23)27/h6-9,14-15H,2-5,10-11H2,1H3/t14-,15-/m0/s1 |
| InChIKey | XAKYAXMPJFUGMZ-GJZGRUSLSA-N |
| XLogP | 1.22 |
| TPSA | 98.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|