C19H16BrN3O5 — CID 2430939
(7-bromo-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]acetate (PubChem CID 2430939) has the molecular formula C19H16BrN3O5 and a molecular weight of 446.26 g/mol. Its IUPAC name is (7-bromo-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]acetate.
| Compound Name | (7-bromo-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]acetate |
|---|---|
| PubChem CID | 2430939 |
| Molecular Formula | C19H16BrN3O5 |
| Molecular Weight | 446.26 g/mol |
| Exact Mass | 445.03 |
| IUPAC Name | (7-bromo-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]acetate |
| SMILES | O=C(CN1C(=O)[C@@H]2CC=CC[C@H]2C1=O)OCc1cc(=O)n2cc(Br)ccc2n1 |
| InChI | InChI=1S/C19H16BrN3O5/c20-11-5-6-15-21-12(7-16(24)22(15)8-11)10-28-17(25)9-23-18(26)13-3-1-2-4-14(13)19(23)27/h1-2,5-8,13-14H,3-4,9-10H2/t13-,14-/m1/s1 |
| InChIKey | JKNZJBJIXWMYIL-ZIAGYGMSSA-N |
| XLogP | 1.45 |
| TPSA | 98.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.26 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|