C21H21ClN2O4 — CID 7542146
(7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 4-(4-chloro-2-methylphenoxy)butanoate (PubChem CID 7542146) has the molecular formula C21H21ClN2O4 and a molecular weight of 400.86 g/mol. Its IUPAC name is (7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 4-(4-chloro-2-methylphenoxy)butanoate.
| Compound Name | (7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 4-(4-chloro-2-methylphenoxy)butanoate |
|---|---|
| PubChem CID | 7542146 |
| Molecular Formula | C21H21ClN2O4 |
| Molecular Weight | 400.86 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | (7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 4-(4-chloro-2-methylphenoxy)butanoate |
| SMILES | Cc1ccc2nc(COC(=O)CCCOc3ccc(Cl)cc3C)cc(=O)n2c1 |
| InChI | InChI=1S/C21H21ClN2O4/c1-14-5-8-19-23-17(11-20(25)24(19)12-14)13-28-21(26)4-3-9-27-18-7-6-16(22)10-15(18)2/h5-8,10-12H,3-4,9,13H2,1-2H3 |
| InChIKey | ZETYKKHKFYLLBO-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.86 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|