C9H9NO7P2 — CID 175570142
[5-(2-amino-2-carboxyethyl)-2-hydroxy-3-phosphophenyl]-oxido-oxophosphanium (PubChem CID 175570142) has the molecular formula C9H9NO7P2 and a molecular weight of 305.12 g/mol. Its IUPAC name is [5-(2-amino-2-carboxyethyl)-2-hydroxy-3-phosphophenyl]-oxido-oxophosphanium.
| Compound Name | [5-(2-amino-2-carboxyethyl)-2-hydroxy-3-phosphophenyl]-oxido-oxophosphanium |
|---|---|
| PubChem CID | 175570142 |
| Molecular Formula | C9H9NO7P2 |
| Molecular Weight | 305.12 g/mol |
| Exact Mass | 304.99 |
| IUPAC Name | [5-(2-amino-2-carboxyethyl)-2-hydroxy-3-phosphophenyl]-oxido-oxophosphanium |
| SMILES | NC(Cc1cc([P+](=O)[O-])c(O)c([P+](=O)[O-])c1)C(=O)O |
| InChI | InChI=1S/C9H9NO7P2/c10-5(9(12)13)1-4-2-6(18(14)15)8(11)7(3-4)19(16)17/h2-3,5,11H,1,10H2,(H,12,13) |
| InChIKey | IGUBVUACFCWWBB-UHFFFAOYSA-N |
| XLogP | -2.20 |
| TPSA | 163.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.12 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|