C20H25ClN2O5 — CID 87623017
[(2S,3R)-1-[[(2S)-3-(3,4-dihydroxyphenyl)-1-methoxy-1-oxopropan-2-yl]amino]-1-oxo-3-phenylbutan-2-yl]azanium chloride (PubChem CID 87623017) has the molecular formula C20H25ClN2O5 and a molecular weight of 408.88 g/mol. Its IUPAC name is [(2S,3R)-1-[[(2S)-3-(3,4-dihydroxyphenyl)-1-methoxy-1-oxopropan-2-yl]amino]-1-oxo-3-phenylbutan-2-yl]azanium chloride.
| Compound Name | [(2S,3R)-1-[[(2S)-3-(3,4-dihydroxyphenyl)-1-methoxy-1-oxopropan-2-yl]amino]-1-oxo-3-phenylbutan-2-yl]azanium chloride |
|---|---|
| PubChem CID | 87623017 |
| Molecular Formula | C20H25ClN2O5 |
| Molecular Weight | 408.88 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | [(2S,3R)-1-[[(2S)-3-(3,4-dihydroxyphenyl)-1-methoxy-1-oxopropan-2-yl]amino]-1-oxo-3-phenylbutan-2-yl]azanium chloride |
| SMILES | COC(=O)[C@H](Cc1ccc(O)c(O)c1)NC(=O)[C@@H]([NH3+])[C@H](C)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C20H24N2O5.ClH/c1-12(14-6-4-3-5-7-14)18(21)19(25)22-15(20(26)27-2)10-13-8-9-16(23)17(24)11-13;/h3-9,11-12,15,18,23-24H,10,21H2,1-2H3,(H,22,25);1H/t12-,15+,18+;/m1./s1 |
| InChIKey | YHPUZYMAXBTUFF-ATBFSLIGSA-N |
| XLogP | -2.28 |
| TPSA | 123.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.88 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|