C35H34B2N4O11 — CID 170523668
(2,5-dioxopyrrolidin-1-yl) 2-[(3R)-2-[(2S,3S)-2,3-bis[(1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)amino]butanoyl]-3,4-dihydro-1H-isoquinolin-3-yl]acetate (PubChem CID 170523668) has the molecular formula C35H34B2N4O11 and a molecular weight of 708.30 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-[(3R)-2-[(2S,3S)-2,3-bis[(1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)amino]butanoyl]-3,4-dihydro-1H-isoquinolin-3-yl]acetate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-[(3R)-2-[(2S,3S)-2,3-bis[(1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)amino]butanoyl]-3,4-dihydro-1H-isoquinolin-3-yl]acetate |
|---|---|
| PubChem CID | 170523668 |
| Molecular Formula | C35H34B2N4O11 |
| Molecular Weight | 708.30 g/mol |
| Exact Mass | 708.24 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[(3R)-2-[(2S,3S)-2,3-bis[(1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)amino]butanoyl]-3,4-dihydro-1H-isoquinolin-3-yl]acetate |
| SMILES | C[C@H](NC(=O)c1ccc2c(c1)B(O)OC2)[C@H](NC(=O)c1ccc2c(c1)B(O)OC2)C(=O)N1Cc2ccccc2C[C@@H]1CC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C35H34B2N4O11/c1-19(38-33(45)21-6-8-24-17-50-36(48)27(24)13-21)32(39-34(46)22-7-9-25-18-51-37(49)28(25)14-22)35(47)40-16-23-5-3-2-4-20(23)12-26(40)15-31(44)52-41-29(42)10-11-30(41)43/h2-9,13-14,19,26,32,48-49H,10-12,15-18H2,1H3,(H,38,45)(H,39,46)/t19-,26+,32-/m0/s1 |
| InChIKey | FLMLBZJZLNWSJQ-MUGYHNDRSA-N |
| XLogP | -1.01 |
| TPSA | 201.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.30 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|