C11H12N2S — CID 1079755
(1-methyl-3,4-dihydro-2H-quinolin-6-yl) thiocyanate (PubChem CID 1079755) has the molecular formula C11H12N2S and a molecular weight of 204.30 g/mol. Its IUPAC name is (1-methyl-3,4-dihydro-2H-quinolin-6-yl) thiocyanate.
| Compound Name | (1-methyl-3,4-dihydro-2H-quinolin-6-yl) thiocyanate |
|---|---|
| PubChem CID | 1079755 |
| Molecular Formula | C11H12N2S |
| Molecular Weight | 204.30 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | (1-methyl-3,4-dihydro-2H-quinolin-6-yl) thiocyanate |
| SMILES | CN1CCCc2cc(SC#N)ccc21 |
| InChI | InChI=1S/C11H12N2S/c1-13-6-2-3-9-7-10(14-8-12)4-5-11(9)13/h4-5,7H,2-3,6H2,1H3 |
| InChIKey | OMRJGLFGRJSYQC-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.30 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|