C24H24ClN3O3S — CID 55872525
(E)-3-(1-benzyl-5-chloro-3-methylpyrazol-4-yl)-1-(6-methylsulfonyl-3,4-dihydro-2H-quinolin-1-yl)prop-2-en-1-one (PubChem CID 55872525) has the molecular formula C24H24ClN3O3S and a molecular weight of 469.99 g/mol. Its IUPAC name is (E)-3-(1-benzyl-5-chloro-3-methylpyrazol-4-yl)-1-(6-methylsulfonyl-3,4-dihydro-2H-quinolin-1-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(1-benzyl-5-chloro-3-methylpyrazol-4-yl)-1-(6-methylsulfonyl-3,4-dihydro-2H-quinolin-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 55872525 |
| Molecular Formula | C24H24ClN3O3S |
| Molecular Weight | 469.99 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | (E)-3-(1-benzyl-5-chloro-3-methylpyrazol-4-yl)-1-(6-methylsulfonyl-3,4-dihydro-2H-quinolin-1-yl)prop-2-en-1-one |
| SMILES | Cc1nn(Cc2ccccc2)c(Cl)c1/C=C/C(=O)N1CCCc2cc(S(C)(=O)=O)ccc21 |
| InChI | InChI=1S/C24H24ClN3O3S/c1-17-21(24(25)28(26-17)16-18-7-4-3-5-8-18)11-13-23(29)27-14-6-9-19-15-20(32(2,30)31)10-12-22(19)27/h3-5,7-8,10-13,15H,6,9,14,16H2,1-2H3/b13-11+ |
| InChIKey | IDITZQWNBGDPKF-ACCUITESSA-N |
| XLogP | 4.29 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.99 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|