C18H20N2O4S — CID 17416161
furan-2-yl-(5-piperidin-1-ylsulfonyl-2,3-dihydroindol-1-yl)methanone (PubChem CID 17416161) has the molecular formula C18H20N2O4S and a molecular weight of 360.44 g/mol. Its IUPAC name is furan-2-yl-(5-piperidin-1-ylsulfonyl-2,3-dihydroindol-1-yl)methanone.
| Compound Name | furan-2-yl-(5-piperidin-1-ylsulfonyl-2,3-dihydroindol-1-yl)methanone |
|---|---|
| PubChem CID | 17416161 |
| Molecular Formula | C18H20N2O4S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | furan-2-yl-(5-piperidin-1-ylsulfonyl-2,3-dihydroindol-1-yl)methanone |
| SMILES | O=C(c1ccco1)N1CCc2cc(S(=O)(=O)N3CCCCC3)ccc21 |
| InChI | InChI=1S/C18H20N2O4S/c21-18(17-5-4-12-24-17)20-11-8-14-13-15(6-7-16(14)20)25(22,23)19-9-2-1-3-10-19/h4-7,12-13H,1-3,8-11H2 |
| InChIKey | JYOLIMSOSRMNAR-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |