C16H19FN2O3S — CID 167990347
2-fluoro-1-(5-piperidin-1-ylsulfonyl-2,3-dihydroindol-1-yl)prop-2-en-1-one (PubChem CID 167990347) has the molecular formula C16H19FN2O3S and a molecular weight of 338.40 g/mol. Its IUPAC name is 2-fluoro-1-(5-piperidin-1-ylsulfonyl-2,3-dihydroindol-1-yl)prop-2-en-1-one.
| Compound Name | 2-fluoro-1-(5-piperidin-1-ylsulfonyl-2,3-dihydroindol-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 167990347 |
| Molecular Formula | C16H19FN2O3S |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 2-fluoro-1-(5-piperidin-1-ylsulfonyl-2,3-dihydroindol-1-yl)prop-2-en-1-one |
| SMILES | C=C(F)C(=O)N1CCc2cc(S(=O)(=O)N3CCCCC3)ccc21 |
| InChI | InChI=1S/C16H19FN2O3S/c1-12(17)16(20)19-10-7-13-11-14(5-6-15(13)19)23(21,22)18-8-3-2-4-9-18/h5-6,11H,1-4,7-10H2 |
| InChIKey | IPFALRXWIVMVLB-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|