C21H31N3O3S — CID 78829310
2-[ethyl(2-methylprop-2-enyl)amino]-1-(5-piperidin-1-ylsulfonyl-2,3-dihydroindol-1-yl)ethanone (PubChem CID 78829310) has the molecular formula C21H31N3O3S and a molecular weight of 405.56 g/mol. Its IUPAC name is 2-[ethyl(2-methylprop-2-enyl)amino]-1-(5-piperidin-1-ylsulfonyl-2,3-dihydroindol-1-yl)ethanone.
| Compound Name | 2-[ethyl(2-methylprop-2-enyl)amino]-1-(5-piperidin-1-ylsulfonyl-2,3-dihydroindol-1-yl)ethanone |
|---|---|
| PubChem CID | 78829310 |
| Molecular Formula | C21H31N3O3S |
| Molecular Weight | 405.56 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | 2-[ethyl(2-methylprop-2-enyl)amino]-1-(5-piperidin-1-ylsulfonyl-2,3-dihydroindol-1-yl)ethanone |
| SMILES | C=C(C)CN(CC)CC(=O)N1CCc2cc(S(=O)(=O)N3CCCCC3)ccc21 |
| InChI | InChI=1S/C21H31N3O3S/c1-4-22(15-17(2)3)16-21(25)24-13-10-18-14-19(8-9-20(18)24)28(26,27)23-11-6-5-7-12-23/h8-9,14H,2,4-7,10-13,15-16H2,1,3H3 |
| InChIKey | HGBHAVWOCCWBNH-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.56 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|