C19H18ClN5O3 — CID 55962088
(E)-3-(3-chloro-4,5-dimethoxyphenyl)-N-[[2-(1,2,4-triazol-1-yl)-3-pyridinyl]methyl]prop-2-enamide (PubChem CID 55962088) has the molecular formula C19H18ClN5O3 and a molecular weight of 399.84 g/mol. Its IUPAC name is (E)-3-(3-chloro-4,5-dimethoxyphenyl)-N-[[2-(1,2,4-triazol-1-yl)-3-pyridinyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(3-chloro-4,5-dimethoxyphenyl)-N-[[2-(1,2,4-triazol-1-yl)-3-pyridinyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 55962088 |
| Molecular Formula | C19H18ClN5O3 |
| Molecular Weight | 399.84 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | (E)-3-(3-chloro-4,5-dimethoxyphenyl)-N-[[2-(1,2,4-triazol-1-yl)-3-pyridinyl]methyl]prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)NCc2cccnc2-n2cncn2)cc(Cl)c1OC |
| InChI | InChI=1S/C19H18ClN5O3/c1-27-16-9-13(8-15(20)18(16)28-2)5-6-17(26)23-10-14-4-3-7-22-19(14)25-12-21-11-24-25/h3-9,11-12H,10H2,1-2H3,(H,23,26)/b6-5+ |
| InChIKey | AVUBNXNOQLUQBJ-AATRIKPKSA-N |
| XLogP | 2.66 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.84 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|