C20H24N2O6 — CID 24511843
N-(3,4-dimethoxyphenyl)-2-[(E)-(3,4-dimethoxyphenyl)methylideneamino]oxypropanamide (PubChem CID 24511843) has the molecular formula C20H24N2O6 and a molecular weight of 388.42 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-2-[(E)-(3,4-dimethoxyphenyl)methylideneamino]oxypropanamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-2-[(E)-(3,4-dimethoxyphenyl)methylideneamino]oxypropanamide |
|---|---|
| PubChem CID | 24511843 |
| Molecular Formula | C20H24N2O6 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-2-[(E)-(3,4-dimethoxyphenyl)methylideneamino]oxypropanamide |
| SMILES | COc1ccc(/C=N/OC(C)C(=O)Nc2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C20H24N2O6/c1-13(20(23)22-15-7-9-17(25-3)19(11-15)27-5)28-21-12-14-6-8-16(24-2)18(10-14)26-4/h6-13H,1-5H3,(H,22,23)/b21-12+ |
| InChIKey | PYPONBRBKVNUJQ-CIAFOILYSA-N |
| XLogP | 3.10 |
| TPSA | 87.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|