4-(3,4-dimethoxyanilino)-2,3-dimethyl-4-oxobutanoic acid

C14H19NO5 — CID 103496094

IUPAC4-(3,4-dimethoxyanilino)-2,3-dimethyl-4-oxobutanoic acid
SMILESCOc1ccc(NC(=O)C(C)C(C)C(=O)O)cc1OC
InChIInChI=1S/C14H19NO5/c1-8(9(2)14(17)18)13(16)15-10-5-6-11(19-3)12(7-10)20-4/h5-9H,1-4H3,(H,15,16)(H,17,18)
InChIKeyYZZZRRZVUCLHEM-UHFFFAOYSA-N
MW281.31 g/mol
LogP2.00
Rot. Bonds6

About 4-(3,4-dimethoxyanilino)-2,3-dimethyl-4-oxobutanoic acid

4-(3,4-dimethoxyanilino)-2,3-dimethyl-4-oxobutanoic acid (PubChem CID 103496094) has the molecular formula C14H19NO5 and a molecular weight of 281.31 g/mol. Its IUPAC name is 4-(3,4-dimethoxyanilino)-2,3-dimethyl-4-oxobutanoic acid.

Molecular Properties

Compound Name4-(3,4-dimethoxyanilino)-2,3-dimethyl-4-oxobutanoic acid
PubChem CID103496094
Molecular FormulaC14H19NO5
Molecular Weight281.31 g/mol
Exact Mass281.13
IUPAC Name4-(3,4-dimethoxyanilino)-2,3-dimethyl-4-oxobutanoic acid
SMILESCOc1ccc(NC(=O)C(C)C(C)C(=O)O)cc1OC
InChIInChI=1S/C14H19NO5/c1-8(9(2)14(17)18)13(16)15-10-5-6-11(19-3)12(7-10)20-4/h5-9H,1-4H3,(H,15,16)(H,17,18)
InChIKeyYZZZRRZVUCLHEM-UHFFFAOYSA-N
XLogP2.00
TPSA84.86 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500281.31
LogP ≤ 52.00
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 4-(3,4-dimethoxyanilino)-2,3-dimethyl-4-oxobutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(3,4-dimethoxyanilino)-2,3-dimethyl-4-oxobutanoic acid?
The IUPAC name of 4-(3,4-dimethoxyanilino)-2,3-dimethyl-4-oxobutanoic acid (CID 103496094) is 4-(3,4-dimethoxyanilino)-2,3-dimethyl-4-oxobutanoic acid.
What is the SMILES notation for 4-(3,4-dimethoxyanilino)-2,3-dimethyl-4-oxobutanoic acid?
The canonical SMILES for 4-(3,4-dimethoxyanilino)-2,3-dimethyl-4-oxobutanoic acid is COc1ccc(NC(=O)C(C)C(C)C(=O)O)cc1OC.
What is the InChIKey of 4-(3,4-dimethoxyanilino)-2,3-dimethyl-4-oxobutanoic acid?
The InChIKey is YZZZRRZVUCLHEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO5/c1-8(9(2)14(17)18)13(16)15-10-5-6-11(19-3)12(7-10)20-4/h5-9H,1-4H3,(H,15,16)(H,17,18).
What are the key properties of 4-(3,4-dimethoxyanilino)-2,3-dimethyl-4-oxobutanoic acid?
4-(3,4-dimethoxyanilino)-2,3-dimethyl-4-oxobutanoic acid has a molecular weight of 281.31 g/mol, XLogP of 2.00, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-dimethoxyanilino)-2,3-dimethyl-4-oxobutanoic acid is sourced from PubChem (CID 103496094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).