C20H27Cl2FN4O — CID 120569030
N-(5-amino-2-methylphenyl)-2-[4-(4-fluorophenyl)piperazin-1-yl]propanamide;dihydrochloride (PubChem CID 120569030) has the molecular formula C20H27Cl2FN4O and a molecular weight of 429.37 g/mol. Its IUPAC name is N-(5-amino-2-methylphenyl)-2-[4-(4-fluorophenyl)piperazin-1-yl]propanamide;dihydrochloride.
| Compound Name | N-(5-amino-2-methylphenyl)-2-[4-(4-fluorophenyl)piperazin-1-yl]propanamide;dihydrochloride |
|---|---|
| PubChem CID | 120569030 |
| Molecular Formula | C20H27Cl2FN4O |
| Molecular Weight | 429.37 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | N-(5-amino-2-methylphenyl)-2-[4-(4-fluorophenyl)piperazin-1-yl]propanamide;dihydrochloride |
| SMILES | Cc1ccc(N)cc1NC(=O)C(C)N1CCN(c2ccc(F)cc2)CC1.Cl.Cl |
| InChI | InChI=1S/C20H25FN4O.2ClH/c1-14-3-6-17(22)13-19(14)23-20(26)15(2)24-9-11-25(12-10-24)18-7-4-16(21)5-8-18;;/h3-8,13,15H,9-12,22H2,1-2H3,(H,23,26);2*1H |
| InChIKey | FBBTZPUHCFLSSG-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.37 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|