C21H27F3N2O2 — CID 119787917
3-piperidin-4-yl-1-[4-(2,4,6-trifluorobenzoyl)piperidin-1-yl]butan-1-one (PubChem CID 119787917) has the molecular formula C21H27F3N2O2 and a molecular weight of 396.45 g/mol. Its IUPAC name is 3-piperidin-4-yl-1-[4-(2,4,6-trifluorobenzoyl)piperidin-1-yl]butan-1-one.
| Compound Name | 3-piperidin-4-yl-1-[4-(2,4,6-trifluorobenzoyl)piperidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 119787917 |
| Molecular Formula | C21H27F3N2O2 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 3-piperidin-4-yl-1-[4-(2,4,6-trifluorobenzoyl)piperidin-1-yl]butan-1-one |
| SMILES | CC(CC(=O)N1CCC(C(=O)c2c(F)cc(F)cc2F)CC1)C1CCNCC1 |
| InChI | InChI=1S/C21H27F3N2O2/c1-13(14-2-6-25-7-3-14)10-19(27)26-8-4-15(5-9-26)21(28)20-17(23)11-16(22)12-18(20)24/h11-15,25H,2-10H2,1H3 |
| InChIKey | CIWQUYBDHRJBEP-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |